Compound

FAD(3-)

A condensation product of riboflavin and adenosine diphosphate. The coenzyme of various aerobic dehydrogenases, e.g., D-amino acid oxidase and L-amino acid oxidase. (Lehninger, Principles of Biochemistry, 1982, p972)

Definition from MeSH (D005182), National Library of Medicine, read 2026-09-23. NLM revises MeSH; this copy may not reflect its current record.

CHEBI:57692ChEBI

Open in the graph

Structure

2D depiction

No three-dimensional record for this entry.

Class: Organic compound, anion
Formula: C27H30N9O15P2
Mass: 782.533 g/mol
Charge: -3
InChIKey: IMGVNJNCCGXBHD-UYBVJOGSSA-K
SMILES: Cc1cc2nc3c(=O)[n-]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])OP(=O)([O-])OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)c2cc1C
Look it up: ChEBI By InChIKey

Identity from ChEBI. Not evidence.

What the reference databases state

Statements

105 statements

105 statements · 2 reference databases · Subject: FAD(3-) · Sources: Rhea, UniProt

Order

ACAD10 requires the cofactor FAD(3-)ProteinUniProt Q6JQN1Inferred only
ACAD11 requires the cofactor FAD(3-)ProteinUniProt Q709F0Inferred only
ACAD8 requires the cofactor FAD(3-)ProteinUniProt Q9UKU7Inferred only
ACAD9 requires the cofactor FAD(3-)ProteinUniProt Q9H845Inferred only
ACADL requires the cofactor FAD(3-)ProteinUniProt P28330Inferred only
ACADM requires the cofactor FAD(3-)ProteinUniProt P11310Inferred only
ACADS requires the cofactor FAD(3-)ProteinUniProt P16219Inferred only
ACADSB requires the cofactor FAD(3-)ProteinUniProt P45954Inferred only
ACADVL requires the cofactor FAD(3-)ProteinUniProt P49748Inferred only
ACOX1 requires the cofactor FAD(3-)ProteinUniProt Q15067Inferred only
ACOX2 requires the cofactor FAD(3-)ProteinUniProt Q99424Inferred only
ACOX3 requires the cofactor FAD(3-)ProteinUniProt O15254Inferred only

Show the remaining 93

ACOXL requires the cofactor FAD(3-)ProteinUniProt Q9NUZ1Inferred only
AGPS requires the cofactor FAD(3-)ProteinUniProt O00116Inferred only
AIFM1 requires the cofactor FAD(3-)ProteinUniProt O95831Inferred only
AOX1 requires the cofactor FAD(3-)ProteinUniProt Q06278Inferred only
CHDH requires the cofactor FAD(3-)ProteinUniProt Q8NE62Inferred only
COQ6 requires the cofactor FAD(3-)ProteinUniProt Q9Y2Z9Inferred only
CRY1 requires the cofactor FAD(3-)ProteinUniProt Q16526Inferred only
CRY2 requires the cofactor FAD(3-)ProteinUniProt Q49AN0Inferred only
CYB5R1 requires the cofactor FAD(3-)ProteinUniProt Q9UHQ9Inferred only
CYB5R2 requires the cofactor FAD(3-)ProteinUniProt Q6BCY4Inferred only
CYB5R3 requires the cofactor FAD(3-)ProteinUniProt P00387Inferred only
CYB5R4 requires the cofactor FAD(3-)ProteinUniProt Q7L1T6Inferred only
CYB5RL requires the cofactor FAD(3-)ProteinUniProt Q6IPT4Inferred only
CYBB requires the cofactor FAD(3-)ProteinUniProt P04839Inferred only
D2HGDH requires the cofactor FAD(3-)ProteinUniProt Q8N465Inferred only
DAO requires the cofactor FAD(3-)ProteinUniProt P14920Inferred only
DDO requires the cofactor FAD(3-)ProteinUniProt Q99489Inferred only
DHCR24 requires the cofactor FAD(3-)ProteinUniProt Q15392Inferred only
DLD requires the cofactor FAD(3-)ProteinUniProt P09622Inferred only
DMGDH requires the cofactor FAD(3-)ProteinUniProt Q9UI17Inferred only
DPYD requires the cofactor FAD(3-)ProteinUniProt Q12882Inferred only
ERO1A requires the cofactor FAD(3-)ProteinUniProt Q96HE7Inferred only
ERO1B requires the cofactor FAD(3-)ProteinUniProt Q86YB8Inferred only
ETFDH requires the cofactor FAD(3-)ProteinUniProt Q16134Inferred only
FDXR requires the cofactor FAD(3-)ProteinUniProt P22570Inferred only
FMO1 requires the cofactor FAD(3-)ProteinUniProt Q01740Inferred only
FMO2 requires the cofactor FAD(3-)ProteinUniProt Q99518Inferred only
FMO3 requires the cofactor FAD(3-)ProteinUniProt P31513Inferred only
FMO4 requires the cofactor FAD(3-)ProteinUniProt P31512Inferred only
FMO5 requires the cofactor FAD(3-)ProteinUniProt P49326Inferred only
FOXRED1 requires the cofactor FAD(3-)ProteinUniProt Q96CU9Inferred only
FOXRED2 requires the cofactor FAD(3-)ProteinUniProt Q8IWF2Inferred only
GCDH requires the cofactor FAD(3-)ProteinUniProt Q92947Inferred only
GFER requires the cofactor FAD(3-)ProteinUniProt P55789Inferred only
GPD2 requires the cofactor FAD(3-)ProteinUniProt P43304Inferred only
GSR requires the cofactor FAD(3-)ProteinUniProt P00390Inferred only
IL4I1 requires the cofactor FAD(3-)ProteinUniProt Q96RQ9Inferred only
IVD requires the cofactor FAD(3-)ProteinUniProt P26440Inferred only
KDM1A requires the cofactor FAD(3-)ProteinUniProt O60341Inferred only
KDM1B requires the cofactor FAD(3-)ProteinUniProt Q8NB78Inferred only
KMO requires the cofactor FAD(3-)ProteinUniProt O15229Inferred only
L2HGDH requires the cofactor FAD(3-)ProteinUniProt Q9H9P8Inferred only
MAOA requires the cofactor FAD(3-)ProteinUniProt P21397Inferred only
MAOB requires the cofactor FAD(3-)ProteinUniProt P27338Inferred only
MICAL1 requires the cofactor FAD(3-)ProteinUniProt Q8TDZ2Inferred only
MICAL2 requires the cofactor FAD(3-)ProteinUniProt O94851Inferred only
MICAL3 requires the cofactor FAD(3-)ProteinUniProt Q7RTP6Inferred only
MMACHC requires the cofactor FAD(3-)ProteinUniProt Q9Y4U1Inferred only
MTHFR requires the cofactor FAD(3-)ProteinUniProt P42898Inferred only
MTO1 requires the cofactor FAD(3-)ProteinUniProt Q9Y2Z2Inferred only
MTRR requires the cofactor FAD(3-)ProteinUniProt Q9UBK8Inferred only
NDOR1 requires the cofactor FAD(3-)ProteinUniProt Q9UHB4Inferred only
NDUFA10 requires the cofactor FAD(3-)ProteinUniProt O95299Inferred only
NDUFA9 requires the cofactor FAD(3-)ProteinUniProt Q16795Inferred only
NOS1 requires the cofactor FAD(3-)ProteinUniProt P29475Inferred only
NOS2 requires the cofactor FAD(3-)ProteinUniProt P35228Inferred only
NOS3 requires the cofactor FAD(3-)ProteinUniProt P29474Inferred only
NOX1 requires the cofactor FAD(3-)ProteinUniProt Q9Y5S8Inferred only
NOX5 requires the cofactor FAD(3-)ProteinUniProt Q96PH1Inferred only
NQO1 requires the cofactor FAD(3-)ProteinUniProt P15559Inferred only
NQO2 requires the cofactor FAD(3-)ProteinUniProt P16083Inferred only
PAOX requires the cofactor FAD(3-)ProteinUniProt Q6QHF9Inferred only
PCYOX1 requires the cofactor FAD(3-)ProteinUniProt Q9UHG3Inferred only
PCYOX1L requires the cofactor FAD(3-)ProteinUniProt Q8NBM8Inferred only
PIPOX requires the cofactor FAD(3-)ProteinUniProt Q9P0Z9Inferred only
POR requires the cofactor FAD(3-)ProteinUniProt P16435Inferred only
PPOX requires the cofactor FAD(3-)ProteinUniProt P50336Inferred only
PRODH requires the cofactor FAD(3-)ProteinUniProt O43272Inferred only
PRODH2 requires the cofactor FAD(3-)ProteinUniProt Q9UF12Inferred only
PYROXD1 requires the cofactor FAD(3-)ProteinUniProt Q8WU10Inferred only
QSOX1 requires the cofactor FAD(3-)ProteinUniProt O00391Inferred only
QSOX2 requires the cofactor FAD(3-)ProteinUniProt Q6ZRP7Inferred only
RETSAT requires the cofactor FAD(3-)ProteinUniProt Q6NUM9Inferred only
RNLS requires the cofactor FAD(3-)ProteinUniProt Q5VYX0Inferred only
SARDH requires the cofactor FAD(3-)ProteinUniProt Q9UL12Inferred only
SDHA requires the cofactor FAD(3-)ProteinUniProt P31040Inferred only
SMOX requires the cofactor FAD(3-)ProteinUniProt Q9NWM0Inferred only
SQLE requires the cofactor FAD(3-)ProteinUniProt Q14534Inferred only
SQOR requires the cofactor FAD(3-)ProteinUniProt Q9Y6N5Inferred only
STEAP1 requires the cofactor FAD(3-)ProteinUniProt Q9UHE8Inferred only
STEAP2 requires the cofactor FAD(3-)ProteinUniProt Q8NFT2Inferred only
STEAP3 requires the cofactor FAD(3-)ProteinUniProt Q658P3Inferred only
STEAP4 requires the cofactor FAD(3-)ProteinUniProt Q687X5Inferred only
TXNRD1 requires the cofactor FAD(3-)ProteinUniProt Q16881Inferred only
TXNRD2 requires the cofactor FAD(3-)ProteinUniProt Q9NNW7Inferred only
TXNRD3 requires the cofactor FAD(3-)ProteinUniProt Q86VQ6Inferred only
XDH requires the cofactor FAD(3-)ProteinUniProt P47989Inferred only
FAD(3-) is transported by SLC25A17ProteinRhea RHEA:73087Inferred only
FAD(3-) is transported by SLC25A17ProteinRhea RHEA:73143Inferred only
FAD(3-) is transported by SLC25A17ProteinRhea RHEA:73147Inferred only
FAD(3-) is transported by SLC25A17ProteinRhea RHEA:73163Inferred only
FAD(3-) is transported by SLC25A17ProteinRhea RHEA:73183Inferred only
FAD(3-) is transported by SLC25A32ProteinRhea RHEA:76535Inferred only

Reactions

119 reactions

A common cofactor or currency species. Appears in 119 reactions — see the full list.

Other names

2 names

Resolves to: FAD(3-)

Also called: FADFAD trianion